C17H27N3OS — CID 83979359
2-(3-methylpiperazin-1-yl)-1-(3-methylpiperidin-1-yl)-2-thiophen-2-ylethanone (PubChem CID 83979359) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 2-(3-methylpiperazin-1-yl)-1-(3-methylpiperidin-1-yl)-2-thiophen-2-ylethanone.
| Compound Name | 2-(3-methylpiperazin-1-yl)-1-(3-methylpiperidin-1-yl)-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 83979359 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-(3-methylpiperazin-1-yl)-1-(3-methylpiperidin-1-yl)-2-thiophen-2-ylethanone |
| SMILES | CC1CCCN(C(=O)C(c2cccs2)N2CCNC(C)C2)C1 |
| InChI | InChI=1S/C17H27N3OS/c1-13-5-3-8-20(11-13)17(21)16(15-6-4-10-22-15)19-9-7-18-14(2)12-19/h4,6,10,13-14,16,18H,3,5,7-9,11-12H2,1-2H3 |
| InChIKey | MOSKEPJDDVJHQZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |