C17H27N3O2S — CID 83979467
1-(4-hydroxypiperidin-1-yl)-2-(3-methylpiperazin-1-yl)-2-(3-methylthiophen-2-yl)ethanone (PubChem CID 83979467) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-(4-hydroxypiperidin-1-yl)-2-(3-methylpiperazin-1-yl)-2-(3-methylthiophen-2-yl)ethanone.
| Compound Name | 1-(4-hydroxypiperidin-1-yl)-2-(3-methylpiperazin-1-yl)-2-(3-methylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 83979467 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-(4-hydroxypiperidin-1-yl)-2-(3-methylpiperazin-1-yl)-2-(3-methylthiophen-2-yl)ethanone |
| SMILES | Cc1ccsc1C(C(=O)N1CCC(O)CC1)N1CCNC(C)C1 |
| InChI | InChI=1S/C17H27N3O2S/c1-12-5-10-23-16(12)15(20-9-6-18-13(2)11-20)17(22)19-7-3-14(21)4-8-19/h5,10,13-15,18,21H,3-4,6-9,11H2,1-2H3 |
| InChIKey | KSGXRBGUOQXVSQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |