C13H20N2S — CID 65417458
1-[cyclopropyl(thiophen-2-yl)methyl]-3-methylpiperazine (PubChem CID 65417458) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-[cyclopropyl(thiophen-2-yl)methyl]-3-methylpiperazine.
| Compound Name | 1-[cyclopropyl(thiophen-2-yl)methyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 65417458 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-[cyclopropyl(thiophen-2-yl)methyl]-3-methylpiperazine |
| SMILES | CC1CN(C(c2cccs2)C2CC2)CCN1 |
| InChI | InChI=1S/C13H20N2S/c1-10-9-15(7-6-14-10)13(11-4-5-11)12-3-2-8-16-12/h2-3,8,10-11,13-14H,4-7,9H2,1H3 |
| InChIKey | BCOFFOJLLGJFPR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |