C10H16N2OS — CID 62941144
1-(2-amino-1-thiophen-2-ylethyl)pyrrolidin-3-ol (PubChem CID 62941144) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-(2-amino-1-thiophen-2-ylethyl)pyrrolidin-3-ol.
| Compound Name | 1-(2-amino-1-thiophen-2-ylethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 62941144 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-(2-amino-1-thiophen-2-ylethyl)pyrrolidin-3-ol |
| SMILES | NCC(c1cccs1)N1CCC(O)C1 |
| InChI | InChI=1S/C10H16N2OS/c11-6-9(10-2-1-5-14-10)12-4-3-8(13)7-12/h1-2,5,8-9,13H,3-4,6-7,11H2 |
| InChIKey | YWICFGPHEOJFMZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |