C12H20N2OS — CID 114797177
2-[1-(2-amino-1-thiophen-2-ylethyl)pyrrolidin-3-yl]ethanol (PubChem CID 114797177) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-[1-(2-amino-1-thiophen-2-ylethyl)pyrrolidin-3-yl]ethanol.
| Compound Name | 2-[1-(2-amino-1-thiophen-2-ylethyl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 114797177 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-[1-(2-amino-1-thiophen-2-ylethyl)pyrrolidin-3-yl]ethanol |
| SMILES | NCC(c1cccs1)N1CCC(CCO)C1 |
| InChI | InChI=1S/C12H20N2OS/c13-8-11(12-2-1-7-16-12)14-5-3-10(9-14)4-6-15/h1-2,7,10-11,15H,3-6,8-9,13H2 |
| InChIKey | UDZIWAOOWMRNKQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |