C17H27ClN4 — CID 129365376
1-[(1S)-1-(3-chlorophenyl)-2-piperazin-1-ylethyl]-4-methylpiperazine (PubChem CID 129365376) has the molecular formula C17H27ClN4 and a molecular weight of 322.88 g/mol. Its IUPAC name is 1-[(1S)-1-(3-chlorophenyl)-2-piperazin-1-ylethyl]-4-methylpiperazine.
| Compound Name | 1-[(1S)-1-(3-chlorophenyl)-2-piperazin-1-ylethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 129365376 |
| Molecular Formula | C17H27ClN4 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[(1S)-1-(3-chlorophenyl)-2-piperazin-1-ylethyl]-4-methylpiperazine |
| SMILES | CN1CCN([C@H](CN2CCNCC2)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H27ClN4/c1-20-9-11-22(12-10-20)17(14-21-7-5-19-6-8-21)15-3-2-4-16(18)13-15/h2-4,13,17,19H,5-12,14H2,1H3/t17-/m1/s1 |
| InChIKey | LXFOXNLPQMKKIF-QGZVFWFLSA-N |
| XLogP | 1.53 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |