C14H22ClN3 — CID 58786565
2-(3-chlorophenyl)-N,N-dimethyl-2-piperazin-1-ylethanamine (PubChem CID 58786565) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N,N-dimethyl-2-piperazin-1-ylethanamine.
| Compound Name | 2-(3-chlorophenyl)-N,N-dimethyl-2-piperazin-1-ylethanamine |
|---|---|
| PubChem CID | 58786565 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-(3-chlorophenyl)-N,N-dimethyl-2-piperazin-1-ylethanamine |
| SMILES | CN(C)CC(c1cccc(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C14H22ClN3/c1-17(2)11-14(18-8-6-16-7-9-18)12-4-3-5-13(15)10-12/h3-5,10,14,16H,6-9,11H2,1-2H3 |
| InChIKey | IXRFFWKMSDQACX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |