C13H19Cl3N2 — CID 171286216
1-[(1R)-1-(3-chlorophenyl)prop-2-enyl]piperazine;dihydrochloride (PubChem CID 171286216) has the molecular formula C13H19Cl3N2 and a molecular weight of 309.67 g/mol. Its IUPAC name is 1-[(1R)-1-(3-chlorophenyl)prop-2-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-chlorophenyl)prop-2-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171286216 |
| Molecular Formula | C13H19Cl3N2 |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-[(1R)-1-(3-chlorophenyl)prop-2-enyl]piperazine;dihydrochloride |
| SMILES | C=C[C@H](c1cccc(Cl)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H17ClN2.2ClH/c1-2-13(16-8-6-15-7-9-16)11-4-3-5-12(14)10-11;;/h2-5,10,13,15H,1,6-9H2;2*1H/t13-;;/m1../s1 |
| InChIKey | JETKDRHKNCQONH-FFXKMJQXSA-N |
| XLogP | 3.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|