C13H17IN2 — CID 131360304
1-[(1S)-1-(3-iodophenyl)prop-2-enyl]piperazine (PubChem CID 131360304) has the molecular formula C13H17IN2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 1-[(1S)-1-(3-iodophenyl)prop-2-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(3-iodophenyl)prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 131360304 |
| Molecular Formula | C13H17IN2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 1-[(1S)-1-(3-iodophenyl)prop-2-enyl]piperazine |
| SMILES | C=C[C@@H](c1cccc(I)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H17IN2/c1-2-13(16-8-6-15-7-9-16)11-4-3-5-12(14)10-11/h2-5,10,13,15H,1,6-9H2/t13-/m0/s1 |
| InChIKey | GAFPIMPRTAPRRL-ZDUSSCGKSA-N |
| XLogP | 2.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|