C13H18Cl2FIN2 — CID 171284066
1-[(1S)-1-(2-fluoro-5-iodophenyl)prop-2-enyl]piperazine;dihydrochloride (PubChem CID 171284066) has the molecular formula C13H18Cl2FIN2 and a molecular weight of 419.11 g/mol. Its IUPAC name is 1-[(1S)-1-(2-fluoro-5-iodophenyl)prop-2-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-fluoro-5-iodophenyl)prop-2-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171284066 |
| Molecular Formula | C13H18Cl2FIN2 |
| Molecular Weight | 419.11 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 1-[(1S)-1-(2-fluoro-5-iodophenyl)prop-2-enyl]piperazine;dihydrochloride |
| SMILES | C=C[C@@H](c1cc(I)ccc1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H16FIN2.2ClH/c1-2-13(17-7-5-16-6-8-17)11-9-10(15)3-4-12(11)14;;/h2-4,9,13,16H,1,5-8H2;2*1H/t13-;;/m0../s1 |
| InChIKey | NMUJOSSMYLAYKF-GXKRWWSZSA-N |
| XLogP | 3.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|