C14H19Cl2F4IN2 — CID 171303191
1-[(1S)-4,4,4-trifluoro-1-(2-fluoro-5-iodophenyl)butyl]piperazine;dihydrochloride (PubChem CID 171303191) has the molecular formula C14H19Cl2F4IN2 and a molecular weight of 489.12 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(2-fluoro-5-iodophenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(2-fluoro-5-iodophenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171303191 |
| Molecular Formula | C14H19Cl2F4IN2 |
| Molecular Weight | 489.12 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(2-fluoro-5-iodophenyl)butyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(I)cc1[C@H](CCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C14H17F4IN2.2ClH/c15-12-2-1-10(19)9-11(12)13(3-4-14(16,17)18)21-7-5-20-6-8-21;;/h1-2,9,13,20H,3-8H2;2*1H/t13-;;/m0../s1 |
| InChIKey | HZIVEKCDALBSRB-GXKRWWSZSA-N |
| XLogP | 4.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.12 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|