C14H18Cl2F6N2 — CID 171303885
1-[(1R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butyl]piperazine;dihydrochloride (PubChem CID 171303885) has the molecular formula C14H18Cl2F6N2 and a molecular weight of 399.21 g/mol. Its IUPAC name is 1-[(1R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171303885 |
| Molecular Formula | C14H18Cl2F6N2 |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1-[(1R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1cc(F)c([C@@H](CCC(F)(F)F)N2CCNCC2)cc1F |
| InChI | InChI=1S/C14H16F6N2.2ClH/c15-10-8-12(17)11(16)7-9(10)13(1-2-14(18,19)20)22-5-3-21-4-6-22;;/h7-8,13,21H,1-6H2;2*1H/t13-;;/m1../s1 |
| InChIKey | PNMNHGOIYVNDLH-FFXKMJQXSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|