C15H22FIN2 — CID 171167786
1-[(1S)-1-(2-fluoro-5-iodophenyl)-3-methylbutyl]piperazine (PubChem CID 171167786) has the molecular formula C15H22FIN2 and a molecular weight of 376.26 g/mol. Its IUPAC name is 1-[(1S)-1-(2-fluoro-5-iodophenyl)-3-methylbutyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-fluoro-5-iodophenyl)-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171167786 |
| Molecular Formula | C15H22FIN2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-[(1S)-1-(2-fluoro-5-iodophenyl)-3-methylbutyl]piperazine |
| SMILES | CC(C)C[C@@H](c1cc(I)ccc1F)N1CCNCC1 |
| InChI | InChI=1S/C15H22FIN2/c1-11(2)9-15(19-7-5-18-6-8-19)13-10-12(17)3-4-14(13)16/h3-4,10-11,15,18H,5-9H2,1-2H3/t15-/m0/s1 |
| InChIKey | WSLAJSPSWHXKAE-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|