C13H16ClF4IN2 — CID 171167843
1-[(1S)-3,3,3-trifluoro-1-(2-fluoro-5-iodophenyl)propyl]piperazine;hydrochloride (PubChem CID 171167843) has the molecular formula C13H16ClF4IN2 and a molecular weight of 438.63 g/mol. Its IUPAC name is 1-[(1S)-3,3,3-trifluoro-1-(2-fluoro-5-iodophenyl)propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-3,3,3-trifluoro-1-(2-fluoro-5-iodophenyl)propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167843 |
| Molecular Formula | C13H16ClF4IN2 |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 1-[(1S)-3,3,3-trifluoro-1-(2-fluoro-5-iodophenyl)propyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc(I)cc1[C@H](CC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H15F4IN2.ClH/c14-11-2-1-9(18)7-10(11)12(8-13(15,16)17)20-5-3-19-4-6-20;/h1-2,7,12,19H,3-6,8H2;1H/t12-;/m0./s1 |
| InChIKey | RHWZWTNPTCMUAZ-YDALLXLXSA-N |
| XLogP | 3.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|