C14H18FIN2 — CID 171173178
1-[(1R)-1-(2-fluoro-5-iodophenyl)but-3-enyl]piperazine (PubChem CID 171173178) has the molecular formula C14H18FIN2 and a molecular weight of 360.21 g/mol. Its IUPAC name is 1-[(1R)-1-(2-fluoro-5-iodophenyl)but-3-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(2-fluoro-5-iodophenyl)but-3-enyl]piperazine |
|---|---|
| PubChem CID | 171173178 |
| Molecular Formula | C14H18FIN2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1-[(1R)-1-(2-fluoro-5-iodophenyl)but-3-enyl]piperazine |
| SMILES | C=CC[C@H](c1cc(I)ccc1F)N1CCNCC1 |
| InChI | InChI=1S/C14H18FIN2/c1-2-3-14(18-8-6-17-7-9-18)12-10-11(16)4-5-13(12)15/h2,4-5,10,14,17H,1,3,6-9H2/t14-/m1/s1 |
| InChIKey | UDNRXTXLVIICOK-CQSZACIVSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|