C13H17ClF2N2 — CID 171163000
1-[(1S)-1-(2,4-difluorophenyl)prop-2-enyl]piperazine;hydrochloride (PubChem CID 171163000) has the molecular formula C13H17ClF2N2 and a molecular weight of 274.74 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4-difluorophenyl)prop-2-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2,4-difluorophenyl)prop-2-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171163000 |
| Molecular Formula | C13H17ClF2N2 |
| Molecular Weight | 274.74 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-[(1S)-1-(2,4-difluorophenyl)prop-2-enyl]piperazine;hydrochloride |
| SMILES | C=C[C@@H](c1ccc(F)cc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C13H16F2N2.ClH/c1-2-13(17-7-5-16-6-8-17)11-4-3-10(14)9-12(11)15;/h2-4,9,13,16H,1,5-8H2;1H/t13-;/m0./s1 |
| InChIKey | RTJJAOHBXBBVRV-ZOWNYOTGSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|