C14H17ClF4N2O — CID 171167887
1-[(1S)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine;hydrochloride (PubChem CID 171167887) has the molecular formula C14H17ClF4N2O and a molecular weight of 340.75 g/mol. Its IUPAC name is 1-[(1S)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167887 |
| Molecular Formula | C14H17ClF4N2O |
| Molecular Weight | 340.75 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-[(1S)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine;hydrochloride |
| SMILES | C=C[C@@H](c1cc(OC(F)(F)F)ccc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H16F4N2O.ClH/c1-2-13(20-7-5-19-6-8-20)11-9-10(3-4-12(11)15)21-14(16,17)18;/h2-4,9,13,19H,1,5-8H2;1H/t13-;/m0./s1 |
| InChIKey | AGOCIFHZFIMVKH-ZOWNYOTGSA-N |
| XLogP | 3.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.75 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|