C16H20F4N2O — CID 171178149
1-[(R)-cyclobutyl-[2-fluoro-5-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171178149) has the molecular formula C16H20F4N2O and a molecular weight of 332.34 g/mol. Its IUPAC name is 1-[(R)-cyclobutyl-[2-fluoro-5-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-cyclobutyl-[2-fluoro-5-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171178149 |
| Molecular Formula | C16H20F4N2O |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[(R)-cyclobutyl-[2-fluoro-5-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | Fc1ccc(OC(F)(F)F)cc1[C@@H](C1CCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H20F4N2O/c17-14-5-4-12(23-16(18,19)20)10-13(14)15(11-2-1-3-11)22-8-6-21-7-9-22/h4-5,10-11,15,21H,1-3,6-9H2/t15-/m1/s1 |
| InChIKey | UYHZYSVTUJAHGP-OAHLLOKOSA-N |
| XLogP | 3.47 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |