C19H28ClF3N2O2 — CID 171171221
1-[(R)-cyclohexyl-[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171171221) has the molecular formula C19H28ClF3N2O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is 1-[(R)-cyclohexyl-[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-cyclohexyl-[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171171221 |
| Molecular Formula | C19H28ClF3N2O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[(R)-cyclohexyl-[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperazine;hydrochloride |
| SMILES | COc1ccc(OC(F)(F)F)cc1[C@@H](C1CCCCC1)N1CCNCC1.Cl |
| InChI | InChI=1S/C19H27F3N2O2.ClH/c1-25-17-8-7-15(26-19(20,21)22)13-16(17)18(14-5-3-2-4-6-14)24-11-9-23-10-12-24;/h7-8,13-14,18,23H,2-6,9-12H2,1H3;1H/t18-;/m1./s1 |
| InChIKey | LLOFQCHGRFMXJG-GMUIIQOCSA-N |
| XLogP | 4.54 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |