C14H19Cl2F3N2O — CID 171293086
1-[(1R)-1-[2-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine;dihydrochloride (PubChem CID 171293086) has the molecular formula C14H19Cl2F3N2O and a molecular weight of 359.22 g/mol. Its IUPAC name is 1-[(1R)-1-[2-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-[2-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171293086 |
| Molecular Formula | C14H19Cl2F3N2O |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-[(1R)-1-[2-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine;dihydrochloride |
| SMILES | C=C[C@H](c1ccccc1OC(F)(F)F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H17F3N2O.2ClH/c1-2-12(19-9-7-18-8-10-19)11-5-3-4-6-13(11)20-14(15,16)17;;/h2-6,12,18H,1,7-10H2;2*1H/t12-;;/m1../s1 |
| InChIKey | LOHXXLUCYCBRQX-CURYUGHLSA-N |
| XLogP | 3.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|