C15H19F3N2O2 — CID 171173304
1-[(1R)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine (PubChem CID 171173304) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-[(1R)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine.
| Compound Name | 1-[(1R)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 171173304 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[(1R)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]prop-2-enyl]piperazine |
| SMILES | C=C[C@H](c1ccc(OC(F)(F)F)cc1OC)N1CCNCC1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-3-13(20-8-6-19-7-9-20)12-5-4-11(10-14(12)21-2)22-15(16,17)18/h3-5,10,13,19H,1,6-9H2,2H3/t13-/m1/s1 |
| InChIKey | XDZYBHPRGMIZTL-CYBMUJFWSA-N |
| XLogP | 2.73 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|