C14H19Cl2N3 — CID 171287601
3-[(1R)-1-piperazin-1-ylprop-2-enyl]benzonitrile;dihydrochloride (PubChem CID 171287601) has the molecular formula C14H19Cl2N3 and a molecular weight of 300.23 g/mol. Its IUPAC name is 3-[(1R)-1-piperazin-1-ylprop-2-enyl]benzonitrile;dihydrochloride.
| Compound Name | 3-[(1R)-1-piperazin-1-ylprop-2-enyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171287601 |
| Molecular Formula | C14H19Cl2N3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-[(1R)-1-piperazin-1-ylprop-2-enyl]benzonitrile;dihydrochloride |
| SMILES | C=C[C@H](c1cccc(C#N)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H17N3.2ClH/c1-2-14(17-8-6-16-7-9-17)13-5-3-4-12(10-13)11-15;;/h2-5,10,14,16H,1,6-9H2;2*1H/t14-;;/m1../s1 |
| InChIKey | VGBYXCXEKJVNBD-FMOMHUKBSA-N |
| XLogP | 2.53 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|