C17H25F3N2O2 — CID 171167191
1-[(1S)-1-(4-ethoxy-3-methoxyphenyl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171167191) has the molecular formula C17H25F3N2O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-[(1S)-1-(4-ethoxy-3-methoxyphenyl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1S)-1-(4-ethoxy-3-methoxyphenyl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171167191 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[(1S)-1-(4-ethoxy-3-methoxyphenyl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | CCOc1ccc([C@H](CCC(F)(F)F)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C17H25F3N2O2/c1-3-24-15-5-4-13(12-16(15)23-2)14(6-7-17(18,19)20)22-10-8-21-9-11-22/h4-5,12,14,21H,3,6-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | GTRIOLQRJGGDBY-AWEZNQCLSA-N |
| XLogP | 3.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |