C16H23F3N2O2 — CID 171172220
1-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-3,3,3-trifluoropropyl]piperazine (PubChem CID 171172220) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is 1-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-3,3,3-trifluoropropyl]piperazine.
| Compound Name | 1-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-3,3,3-trifluoropropyl]piperazine |
|---|---|
| PubChem CID | 171172220 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-3,3,3-trifluoropropyl]piperazine |
| SMILES | CCOc1cc([C@@H](CC(F)(F)F)N2CCNCC2)ccc1OC |
| InChI | InChI=1S/C16H23F3N2O2/c1-3-23-15-10-12(4-5-14(15)22-2)13(11-16(17,18)19)21-8-6-20-7-9-21/h4-5,10,13,20H,3,6-9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | CFFDOKAJGHHMQF-CYBMUJFWSA-N |
| XLogP | 2.99 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |