C22H38N2O2 — CID 110826980
N-[2-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]heptan-1-amine (PubChem CID 110826980) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]heptan-1-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]heptan-1-amine |
|---|---|
| PubChem CID | 110826980 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]heptan-1-amine |
| SMILES | CCCCCCCNCC(c1ccc(OC)c(OC)c1)N1CCCCC1 |
| InChI | InChI=1S/C22H38N2O2/c1-4-5-6-7-9-14-23-18-20(24-15-10-8-11-16-24)19-12-13-21(25-2)22(17-19)26-3/h12-13,17,20,23H,4-11,14-16,18H2,1-3H3 |
| InChIKey | MEGTZTTYHDMOFW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|