C16H27N3O4S — CID 110622752
2-(3,4-dimethoxyphenyl)-N-(ethylsulfamoyl)-2-pyrrolidin-1-ylethanamine (PubChem CID 110622752) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(ethylsulfamoyl)-2-pyrrolidin-1-ylethanamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(ethylsulfamoyl)-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 110622752 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(ethylsulfamoyl)-2-pyrrolidin-1-ylethanamine |
| SMILES | CCNS(=O)(=O)NCC(c1ccc(OC)c(OC)c1)N1CCCC1 |
| InChI | InChI=1S/C16H27N3O4S/c1-4-17-24(20,21)18-12-14(19-9-5-6-10-19)13-7-8-15(22-2)16(11-13)23-3/h7-8,11,14,17-18H,4-6,9-10,12H2,1-3H3 |
| InChIKey | ASFSJSBSWJASNK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |