C15H23N3O5S — CID 110626613
2-(1,3-benzodioxol-5-yl)-N-(ethylsulfamoyl)-2-morpholin-4-ylethanamine (PubChem CID 110626613) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(ethylsulfamoyl)-2-morpholin-4-ylethanamine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(ethylsulfamoyl)-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 110626613 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(ethylsulfamoyl)-2-morpholin-4-ylethanamine |
| SMILES | CCNS(=O)(=O)NCC(c1ccc2c(c1)OCO2)N1CCOCC1 |
| InChI | InChI=1S/C15H23N3O5S/c1-2-16-24(19,20)17-10-13(18-5-7-21-8-6-18)12-3-4-14-15(9-12)23-11-22-14/h3-4,9,13,16-17H,2,5-8,10-11H2,1H3 |
| InChIKey | SZWSXAXDFQSEEV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |