C18H26N2O4 — CID 110287527
N-[2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]pentanamide (PubChem CID 110287527) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]pentanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]pentanamide |
|---|---|
| PubChem CID | 110287527 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]pentanamide |
| SMILES | CCCCC(=O)NCC(c1ccc2c(c1)OCO2)N1CCOCC1 |
| InChI | InChI=1S/C18H26N2O4/c1-2-3-4-18(21)19-12-15(20-7-9-22-10-8-20)14-5-6-16-17(11-14)24-13-23-16/h5-6,11,15H,2-4,7-10,12-13H2,1H3,(H,19,21) |
| InChIKey | BYUMWWVWCJKYKM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |