C17H24N2O3 — CID 171280937
[4-[(S)-cyclopropyl(piperazin-1-yl)methyl]-2-methoxyphenyl] acetate (PubChem CID 171280937) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is [4-[(S)-cyclopropyl(piperazin-1-yl)methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(S)-cyclopropyl(piperazin-1-yl)methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 171280937 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [4-[(S)-cyclopropyl(piperazin-1-yl)methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc([C@H](C2CC2)N2CCNCC2)ccc1OC(C)=O |
| InChI | InChI=1S/C17H24N2O3/c1-12(20)22-15-6-5-14(11-16(15)21-2)17(13-3-4-13)19-9-7-18-8-10-19/h5-6,11,13,17-18H,3-4,7-10H2,1-2H3/t17-/m0/s1 |
| InChIKey | AIQJODKOQNLTOS-KRWDZBQOSA-N |
| XLogP | 1.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|