C16H24Cl2N2O3 — CID 171280928
[2-methoxy-4-[(1S)-1-piperazin-1-ylprop-2-enyl]phenyl] acetate;dihydrochloride (PubChem CID 171280928) has the molecular formula C16H24Cl2N2O3 and a molecular weight of 363.29 g/mol. Its IUPAC name is [2-methoxy-4-[(1S)-1-piperazin-1-ylprop-2-enyl]phenyl] acetate;dihydrochloride.
| Compound Name | [2-methoxy-4-[(1S)-1-piperazin-1-ylprop-2-enyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171280928 |
| Molecular Formula | C16H24Cl2N2O3 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [2-methoxy-4-[(1S)-1-piperazin-1-ylprop-2-enyl]phenyl] acetate;dihydrochloride |
| SMILES | C=C[C@@H](c1ccc(OC(C)=O)c(OC)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H22N2O3.2ClH/c1-4-14(18-9-7-17-8-10-18)13-5-6-15(21-12(2)19)16(11-13)20-3;;/h4-6,11,14,17H,1,7-10H2,2-3H3;2*1H/t14-;;/m0../s1 |
| InChIKey | DQUSZMOIOIJULF-UTLKBRERSA-N |
| XLogP | 2.60 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|