C24H34ClNO4 — CID 70551778
[5-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylphenoxy)phenyl] 3-methylbutanoate;hydrochloride (PubChem CID 70551778) has the molecular formula C24H34ClNO4 and a molecular weight of 435.99 g/mol. Its IUPAC name is [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylphenoxy)phenyl] 3-methylbutanoate;hydrochloride.
| Compound Name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylphenoxy)phenyl] 3-methylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 70551778 |
| Molecular Formula | C24H34ClNO4 |
| Molecular Weight | 435.99 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylphenoxy)phenyl] 3-methylbutanoate;hydrochloride |
| SMILES | Cc1ccc(Oc2ccc(C(O)CNC(C)(C)C)cc2OC(=O)CC(C)C)cc1.Cl |
| InChI | InChI=1S/C24H33NO4.ClH/c1-16(2)13-23(27)29-22-14-18(20(26)15-25-24(4,5)6)9-12-21(22)28-19-10-7-17(3)8-11-19;/h7-12,14,16,20,25-26H,13,15H2,1-6H3;1H |
| InChIKey | KDUWDAICNCXJJB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.99 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|