C23H25NO3 — CID 70603684
1-[3,4-bis(4-methylphenoxy)phenyl]-2-(methylamino)ethanol (PubChem CID 70603684) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[3,4-bis(4-methylphenoxy)phenyl]-2-(methylamino)ethanol.
| Compound Name | 1-[3,4-bis(4-methylphenoxy)phenyl]-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 70603684 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-[3,4-bis(4-methylphenoxy)phenyl]-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1ccc(Oc2ccc(C)cc2)c(Oc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H25NO3/c1-16-4-9-19(10-5-16)26-22-13-8-18(21(25)15-24-3)14-23(22)27-20-11-6-17(2)7-12-20/h4-14,21,24-25H,15H2,1-3H3 |
| InChIKey | TVAVGPRVFNOGAJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |