C13H13Cl4NO5 — CID 134501095
[2-(2,2-dichloroacetyl)oxy-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2,2-dichloroacetate (PubChem CID 134501095) has the molecular formula C13H13Cl4NO5 and a molecular weight of 405.06 g/mol. Its IUPAC name is [2-(2,2-dichloroacetyl)oxy-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2,2-dichloroacetate.
| Compound Name | [2-(2,2-dichloroacetyl)oxy-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 134501095 |
| Molecular Formula | C13H13Cl4NO5 |
| Molecular Weight | 405.06 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | [2-(2,2-dichloroacetyl)oxy-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2,2-dichloroacetate |
| SMILES | CNCC(O)c1ccc(OC(=O)C(Cl)Cl)c(OC(=O)C(Cl)Cl)c1 |
| InChI | InChI=1S/C13H13Cl4NO5/c1-18-5-7(19)6-2-3-8(22-12(20)10(14)15)9(4-6)23-13(21)11(16)17/h2-4,7,10-11,18-19H,5H2,1H3 |
| InChIKey | KIOHJXXSJYGRKE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.06 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|