C9H13NO6S — CID 53471836
[2-hydroxy-4-[(1S)-1-hydroxy-2-(methylamino)ethyl]phenyl] hydrogen sulfate (PubChem CID 53471836) has the molecular formula C9H13NO6S and a molecular weight of 263.27 g/mol. Its IUPAC name is [2-hydroxy-4-[(1S)-1-hydroxy-2-(methylamino)ethyl]phenyl] hydrogen sulfate.
| Compound Name | [2-hydroxy-4-[(1S)-1-hydroxy-2-(methylamino)ethyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 53471836 |
| Molecular Formula | C9H13NO6S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | [2-hydroxy-4-[(1S)-1-hydroxy-2-(methylamino)ethyl]phenyl] hydrogen sulfate |
| SMILES | CNC[C@@H](O)c1ccc(OS(=O)(=O)O)c(O)c1 |
| InChI | InChI=1S/C9H13NO6S/c1-10-5-8(12)6-2-3-9(7(11)4-6)16-17(13,14)15/h2-4,8,10-12H,5H2,1H3,(H,13,14,15)/t8-/m1/s1 |
| InChIKey | AELFRHHZGTVYGJ-MRVPVSSYSA-N |
| XLogP | -0.17 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|