C13H21NO6S — CID 46780103
[4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenyl] hydrogen sulfate (PubChem CID 46780103) has the molecular formula C13H21NO6S and a molecular weight of 319.38 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenyl] hydrogen sulfate.
| Compound Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 46780103 |
| Molecular Formula | C13H21NO6S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenyl] hydrogen sulfate |
| SMILES | CC(C)(C)NCC(O)c1ccc(OS(=O)(=O)O)c(CO)c1 |
| InChI | InChI=1S/C13H21NO6S/c1-13(2,3)14-7-11(16)9-4-5-12(10(6-9)8-15)20-21(17,18)19/h4-6,11,14-16H,7-8H2,1-3H3,(H,17,18,19) |
| InChIKey | FPMLHYFHLRTRMB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|