C19H26BNO4 — CID 46946265
[4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenoxy]-phenylborinic acid (PubChem CID 46946265) has the molecular formula C19H26BNO4 and a molecular weight of 343.23 g/mol. Its IUPAC name is [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenoxy]-phenylborinic acid.
| Compound Name | [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenoxy]-phenylborinic acid |
|---|---|
| PubChem CID | 46946265 |
| Molecular Formula | C19H26BNO4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenoxy]-phenylborinic acid |
| SMILES | CC(C)(C)NC[C@H](O)c1ccc(OB(O)c2ccccc2)c(CO)c1 |
| InChI | InChI=1S/C19H26BNO4/c1-19(2,3)21-12-17(23)14-9-10-18(15(11-14)13-22)25-20(24)16-7-5-4-6-8-16/h4-11,17,21-24H,12-13H2,1-3H3/t17-/m0/s1 |
| InChIKey | IGLAYSSBMQSXKH-KRWDZBQOSA-N |
| XLogP | 1.37 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|