C13H23N3O — CID 172782113
1-[4-amino-3-(aminomethyl)phenyl]-2-(tert-butylamino)ethanol (PubChem CID 172782113) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-[4-amino-3-(aminomethyl)phenyl]-2-(tert-butylamino)ethanol.
| Compound Name | 1-[4-amino-3-(aminomethyl)phenyl]-2-(tert-butylamino)ethanol |
|---|---|
| PubChem CID | 172782113 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 1-[4-amino-3-(aminomethyl)phenyl]-2-(tert-butylamino)ethanol |
| SMILES | CC(C)(C)NCC(O)c1ccc(N)c(CN)c1 |
| InChI | InChI=1S/C13H23N3O/c1-13(2,3)16-8-12(17)9-4-5-11(15)10(6-9)7-14/h4-6,12,16-17H,7-8,14-15H2,1-3H3 |
| InChIKey | OJYZLQOTZNFHNN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|