C14H25NO6S — CID 75950939
4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;methanesulfonic acid (PubChem CID 75950939) has the molecular formula C14H25NO6S and a molecular weight of 335.42 g/mol. Its IUPAC name is 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;methanesulfonic acid.
| Compound Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;methanesulfonic acid |
|---|---|
| PubChem CID | 75950939 |
| Molecular Formula | C14H25NO6S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;methanesulfonic acid |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(CO)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C13H21NO3.CH4O3S/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15;1-5(2,3)4/h4-6,12,14-17H,7-8H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | FVDRWFBZHDINJS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|