C15H27NO4 — CID 174929036
4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;ethanol (PubChem CID 174929036) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;ethanol.
| Compound Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;ethanol |
|---|---|
| PubChem CID | 174929036 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;ethanol |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(CO)c1.CCO |
| InChI | InChI=1S/C13H21NO3.C2H6O/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15;1-2-3/h4-6,12,14-17H,7-8H2,1-3H3;3H,2H2,1H3 |
| InChIKey | BHXGYALXHFHSSA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |