C13H22BNO5 — CID 42644902
[4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenoxy]boronic acid (PubChem CID 42644902) has the molecular formula C13H22BNO5 and a molecular weight of 283.13 g/mol. Its IUPAC name is [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenoxy]boronic acid.
| Compound Name | [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenoxy]boronic acid |
|---|---|
| PubChem CID | 42644902 |
| Molecular Formula | C13H22BNO5 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenoxy]boronic acid |
| SMILES | CC(C)(C)NC[C@H](O)c1ccc(OB(O)O)c(CO)c1 |
| InChI | InChI=1S/C13H22BNO5/c1-13(2,3)15-7-11(17)9-4-5-12(20-14(18)19)10(6-9)8-16/h4-6,11,15-19H,7-8H2,1-3H3/t11-/m0/s1 |
| InChIKey | AXCRPUQPHZRZNF-NSHDSACASA-N |
| XLogP | -0.05 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|