C12H19ClI2N2O — CID 70405373
1-(4-amino-3,5-diiodophenyl)-2-(tert-butylamino)ethanol;hydrochloride (PubChem CID 70405373) has the molecular formula C12H19ClI2N2O and a molecular weight of 496.56 g/mol. Its IUPAC name is 1-(4-amino-3,5-diiodophenyl)-2-(tert-butylamino)ethanol;hydrochloride.
| Compound Name | 1-(4-amino-3,5-diiodophenyl)-2-(tert-butylamino)ethanol;hydrochloride |
|---|---|
| PubChem CID | 70405373 |
| Molecular Formula | C12H19ClI2N2O |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 495.93 |
| IUPAC Name | 1-(4-amino-3,5-diiodophenyl)-2-(tert-butylamino)ethanol;hydrochloride |
| SMILES | CC(C)(C)NCC(O)c1cc(I)c(N)c(I)c1.Cl |
| InChI | InChI=1S/C12H18I2N2O.ClH/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7;/h4-5,10,16-17H,6,15H2,1-3H3;1H |
| InChIKey | AEFNXVFPHOOZHN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|