C12H19Cl2N3O3 — CID 3027608
1-(4-amino-3-chloro-5-nitrophenyl)-2-(tert-butylamino)ethanol;hydrochloride (PubChem CID 3027608) has the molecular formula C12H19Cl2N3O3 and a molecular weight of 324.21 g/mol. Its IUPAC name is 1-(4-amino-3-chloro-5-nitrophenyl)-2-(tert-butylamino)ethanol;hydrochloride.
| Compound Name | 1-(4-amino-3-chloro-5-nitrophenyl)-2-(tert-butylamino)ethanol;hydrochloride |
|---|---|
| PubChem CID | 3027608 |
| Molecular Formula | C12H19Cl2N3O3 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-(4-amino-3-chloro-5-nitrophenyl)-2-(tert-butylamino)ethanol;hydrochloride |
| SMILES | CC(C)(C)NCC(O)c1cc(Cl)c(N)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C12H18ClN3O3.ClH/c1-12(2,3)15-6-10(17)7-4-8(13)11(14)9(5-7)16(18)19;/h4-5,10,15,17H,6,14H2,1-3H3;1H |
| InChIKey | QZXLIBQJXSRDAK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|