C22H27Cl2N3O5 — CID 67788892
6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-[1-(2-nitrophenyl)ethyl]hexanoic acid (PubChem CID 67788892) has the molecular formula C22H27Cl2N3O5 and a molecular weight of 484.38 g/mol. Its IUPAC name is 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-[1-(2-nitrophenyl)ethyl]hexanoic acid.
| Compound Name | 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-[1-(2-nitrophenyl)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 67788892 |
| Molecular Formula | C22H27Cl2N3O5 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-[1-(2-nitrophenyl)ethyl]hexanoic acid |
| SMILES | CC(c1ccccc1[N+](=O)[O-])C(CCCCNCC(O)c1cc(Cl)c(N)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C22H27Cl2N3O5/c1-13(15-6-2-3-8-19(15)27(31)32)16(22(29)30)7-4-5-9-26-12-20(28)14-10-17(23)21(25)18(24)11-14/h2-3,6,8,10-11,13,16,20,26,28H,4-5,7,9,12,25H2,1H3,(H,29,30) |
| InChIKey | HEVDEBMMYOQZAH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|