C29H34Cl2N2O5 — CID 23352681
2-(4-phenylmethoxyphenoxy)ethyl 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexanoate (PubChem CID 23352681) has the molecular formula C29H34Cl2N2O5 and a molecular weight of 561.51 g/mol. Its IUPAC name is 2-(4-phenylmethoxyphenoxy)ethyl 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexanoate.
| Compound Name | 2-(4-phenylmethoxyphenoxy)ethyl 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexanoate |
|---|---|
| PubChem CID | 23352681 |
| Molecular Formula | C29H34Cl2N2O5 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 2-(4-phenylmethoxyphenoxy)ethyl 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexanoate |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCC(=O)OCCOc2ccc(OCc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C29H34Cl2N2O5/c30-25-17-22(18-26(31)29(25)32)27(34)19-33-14-6-2-5-9-28(35)37-16-15-36-23-10-12-24(13-11-23)38-20-21-7-3-1-4-8-21/h1,3-4,7-8,10-13,17-18,27,33-34H,2,5-6,9,14-16,19-20,32H2 |
| InChIKey | RIFRBNDJRPBCRF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|