C25H32Cl2N2O7 — CID 67712689
8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-benzyloctanoic acid;oxalic acid (PubChem CID 67712689) has the molecular formula C25H32Cl2N2O7 and a molecular weight of 543.44 g/mol. Its IUPAC name is 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-benzyloctanoic acid;oxalic acid.
| Compound Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-benzyloctanoic acid;oxalic acid |
|---|---|
| PubChem CID | 67712689 |
| Molecular Formula | C25H32Cl2N2O7 |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-benzyloctanoic acid;oxalic acid |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCCC(Cc2ccccc2)C(=O)O)cc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H30Cl2N2O3.C2H2O4/c24-19-13-18(14-20(25)22(19)26)21(28)15-27-11-7-2-1-6-10-17(23(29)30)12-16-8-4-3-5-9-16;3-1(4)2(5)6/h3-5,8-9,13-14,17,21,27-28H,1-2,6-7,10-12,15,26H2,(H,29,30);(H,3,4)(H,5,6) |
| InChIKey | FAFQVABPXCHDTC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|