C28H42Cl2N2O3 — CID 67825238
1-(4-amino-3,5-dichlorophenyl)-2-[[1-phenyl-7-(4-propoxybutoxy)heptan-2-yl]amino]ethanol (PubChem CID 67825238) has the molecular formula C28H42Cl2N2O3 and a molecular weight of 525.56 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[[1-phenyl-7-(4-propoxybutoxy)heptan-2-yl]amino]ethanol.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[[1-phenyl-7-(4-propoxybutoxy)heptan-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 67825238 |
| Molecular Formula | C28H42Cl2N2O3 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[[1-phenyl-7-(4-propoxybutoxy)heptan-2-yl]amino]ethanol |
| SMILES | CCCOCCCCOCCCCCC(Cc1ccccc1)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C28H42Cl2N2O3/c1-2-14-34-16-9-10-17-35-15-8-4-7-13-24(18-22-11-5-3-6-12-22)32-21-27(33)23-19-25(29)28(31)26(30)20-23/h3,5-6,11-12,19-20,24,27,32-33H,2,4,7-10,13-18,21,31H2,1H3 |
| InChIKey | VINYPFOOYAGSRF-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|