C20H29Cl2N3O2S — CID 19876753
1-(4-amino-3,5-dichlorophenyl)-2-[6-[2-(2-methyl-1,3-thiazol-4-yl)ethoxy]hexylamino]ethanol (PubChem CID 19876753) has the molecular formula C20H29Cl2N3O2S and a molecular weight of 446.44 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[6-[2-(2-methyl-1,3-thiazol-4-yl)ethoxy]hexylamino]ethanol.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-[2-(2-methyl-1,3-thiazol-4-yl)ethoxy]hexylamino]ethanol |
|---|---|
| PubChem CID | 19876753 |
| Molecular Formula | C20H29Cl2N3O2S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-[2-(2-methyl-1,3-thiazol-4-yl)ethoxy]hexylamino]ethanol |
| SMILES | Cc1nc(CCOCCCCCCNCC(O)c2cc(Cl)c(N)c(Cl)c2)cs1 |
| InChI | InChI=1S/C20H29Cl2N3O2S/c1-14-25-16(13-28-14)6-9-27-8-5-3-2-4-7-24-12-19(26)15-10-17(21)20(23)18(22)11-15/h10-11,13,19,24,26H,2-9,12,23H2,1H3 |
| InChIKey | FJMKRGAAOLFGMG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|