C13H21Cl3N2O — CID 71314895
1-(4-amino-3,5-dichlorophenyl)-2-[[3,4,4,4-tetradeuterio-3-(trideuteriomethyl)butyl]amino]ethanol;hydrochloride (PubChem CID 71314895) has the molecular formula C13H21Cl3N2O and a molecular weight of 334.73 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[[3,4,4,4-tetradeuterio-3-(trideuteriomethyl)butyl]amino]ethanol;hydrochloride.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[[3,4,4,4-tetradeuterio-3-(trideuteriomethyl)butyl]amino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 71314895 |
| Molecular Formula | C13H21Cl3N2O |
| Molecular Weight | 334.73 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[[3,4,4,4-tetradeuterio-3-(trideuteriomethyl)butyl]amino]ethanol;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])C([2H])(CCNCC(O)c1cc(Cl)c(N)c(Cl)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H20Cl2N2O.ClH/c1-8(2)3-4-17-7-12(18)9-5-10(14)13(16)11(15)6-9;/h5-6,8,12,17-18H,3-4,7,16H2,1-2H3;1H/i1D3,2D3,8D; |
| InChIKey | HEVWUZFPJCXIOO-CZHLNGJYSA-N |
| XLogP | 3.67 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|