C28H36Cl2N2O7 — CID 67712800
8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-(2-phenylethyl)octanoic acid;(Z)-but-2-enedioic acid (PubChem CID 67712800) has the molecular formula C28H36Cl2N2O7 and a molecular weight of 583.51 g/mol. Its IUPAC name is 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-(2-phenylethyl)octanoic acid;(Z)-but-2-enedioic acid.
| Compound Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-(2-phenylethyl)octanoic acid;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 67712800 |
| Molecular Formula | C28H36Cl2N2O7 |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-(2-phenylethyl)octanoic acid;(Z)-but-2-enedioic acid |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCCC(CCc2ccccc2)C(=O)O)cc1Cl.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H32Cl2N2O3.C4H4O4/c25-20-14-19(15-21(26)23(20)27)22(29)16-28-13-7-2-1-6-10-18(24(30)31)12-11-17-8-4-3-5-9-17;5-3(6)1-2-4(7)8/h3-5,8-9,14-15,18,22,28-29H,1-2,6-7,10-13,16,27H2,(H,30,31);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | AFDPEGZMLKGIGL-BTJKTKAUSA-N |
| XLogP | 5.19 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|