C21H27NO3 — CID 67789654
2-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-5-phenylpentanoic acid (PubChem CID 67789654) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-5-phenylpentanoic acid.
| Compound Name | 2-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 67789654 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-5-phenylpentanoic acid |
| SMILES | O=C(O)C(CCCc1ccccc1)CCNCC(O)c1ccccc1 |
| InChI | InChI=1S/C21H27NO3/c23-20(18-11-5-2-6-12-18)16-22-15-14-19(21(24)25)13-7-10-17-8-3-1-4-9-17/h1-6,8-9,11-12,19-20,22-23H,7,10,13-16H2,(H,24,25) |
| InChIKey | XEVRZCNLGWVNLO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|